C27H21ClFN3O2 — CID 99796176
[(3S)-3-(2-chloro-8-ethoxyquinolin-3-yl)-5-phenyl-3,4-dihydropyrazol-2-yl]-(2-fluorophenyl)methanone (PubChem CID 99796176) has the molecular formula C27H21ClFN3O2 and a molecular weight of 473.94 g/mol. Its IUPAC name is [(3S)-3-(2-chloro-8-ethoxyquinolin-3-yl)-5-phenyl-3,4-dihydropyrazol-2-yl]-(2-fluorophenyl)methanone.
| Compound Name | [(3S)-3-(2-chloro-8-ethoxyquinolin-3-yl)-5-phenyl-3,4-dihydropyrazol-2-yl]-(2-fluorophenyl)methanone |
|---|---|
| PubChem CID | 99796176 |
| Molecular Formula | C27H21ClFN3O2 |
| Molecular Weight | 473.94 g/mol |
| Exact Mass | 473.13 |
| IUPAC Name | [(3S)-3-(2-chloro-8-ethoxyquinolin-3-yl)-5-phenyl-3,4-dihydropyrazol-2-yl]-(2-fluorophenyl)methanone |
| SMILES | CCOc1cccc2cc([C@@H]3CC(c4ccccc4)=NN3C(=O)c3ccccc3F)c(Cl)nc12 |
| InChI | InChI=1S/C27H21ClFN3O2/c1-2-34-24-14-8-11-18-15-20(26(28)30-25(18)24)23-16-22(17-9-4-3-5-10-17)31-32(23)27(33)19-12-6-7-13-21(19)29/h3-15,23H,2,16H2,1H3/t23-/m0/s1 |
| InChIKey | WAOHAOOQEQQJLL-QHCPKHFHSA-N |
| XLogP | 6.42 |
| TPSA | 54.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.94 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|