C23H19Cl2N3O4 — CID 99797619
4-[(3S)-3-(2-chloro-8-methoxyquinolin-3-yl)-5-(3-chlorophenyl)-3,4-dihydropyrazol-2-yl]-4-oxobutanoic acid (PubChem CID 99797619) has the molecular formula C23H19Cl2N3O4 and a molecular weight of 472.33 g/mol. Its IUPAC name is 4-[(3S)-3-(2-chloro-8-methoxyquinolin-3-yl)-5-(3-chlorophenyl)-3,4-dihydropyrazol-2-yl]-4-oxobutanoic acid.
| Compound Name | 4-[(3S)-3-(2-chloro-8-methoxyquinolin-3-yl)-5-(3-chlorophenyl)-3,4-dihydropyrazol-2-yl]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 99797619 |
| Molecular Formula | C23H19Cl2N3O4 |
| Molecular Weight | 472.33 g/mol |
| Exact Mass | 471.08 |
| IUPAC Name | 4-[(3S)-3-(2-chloro-8-methoxyquinolin-3-yl)-5-(3-chlorophenyl)-3,4-dihydropyrazol-2-yl]-4-oxobutanoic acid |
| SMILES | COc1cccc2cc([C@@H]3CC(c4cccc(Cl)c4)=NN3C(=O)CCC(=O)O)c(Cl)nc12 |
| InChI | InChI=1S/C23H19Cl2N3O4/c1-32-19-7-3-5-14-11-16(23(25)26-22(14)19)18-12-17(13-4-2-6-15(24)10-13)27-28(18)20(29)8-9-21(30)31/h2-7,10-11,18H,8-9,12H2,1H3,(H,30,31)/t18-/m0/s1 |
| InChIKey | ZTMFGDBJRHICLO-SFHVURJKSA-N |
| XLogP | 5.09 |
| TPSA | 92.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.33 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|