C23H18Cl2N2O3 — CID 40806082
[2-[(3S)-2-acetyl-3-(2,4-dichlorophenyl)-3,4-dihydropyrazol-5-yl]naphthalen-1-yl] acetate (PubChem CID 40806082) has the molecular formula C23H18Cl2N2O3 and a molecular weight of 441.31 g/mol. Its IUPAC name is [2-[(3S)-2-acetyl-3-(2,4-dichlorophenyl)-3,4-dihydropyrazol-5-yl]naphthalen-1-yl] acetate.
| Compound Name | [2-[(3S)-2-acetyl-3-(2,4-dichlorophenyl)-3,4-dihydropyrazol-5-yl]naphthalen-1-yl] acetate |
|---|---|
| PubChem CID | 40806082 |
| Molecular Formula | C23H18Cl2N2O3 |
| Molecular Weight | 441.31 g/mol |
| Exact Mass | 440.07 |
| IUPAC Name | [2-[(3S)-2-acetyl-3-(2,4-dichlorophenyl)-3,4-dihydropyrazol-5-yl]naphthalen-1-yl] acetate |
| SMILES | CC(=O)Oc1c(C2=NN(C(C)=O)[C@H](c3ccc(Cl)cc3Cl)C2)ccc2ccccc12 |
| InChI | InChI=1S/C23H18Cl2N2O3/c1-13(28)27-22(18-10-8-16(24)11-20(18)25)12-21(26-27)19-9-7-15-5-3-4-6-17(15)23(19)30-14(2)29/h3-11,22H,12H2,1-2H3/t22-/m0/s1 |
| InChIKey | DVRUSMBFCTZEKY-QFIPXVFZSA-N |
| XLogP | 5.77 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.31 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|