C23H22N2O4 — CID 136690179
1-[(3R)-3-(3,4-dimethoxyphenyl)-5-(2-hydroxynaphthalen-1-yl)-3,4-dihydropyrazol-2-yl]ethanone (PubChem CID 136690179) has the molecular formula C23H22N2O4 and a molecular weight of 390.44 g/mol. Its IUPAC name is 1-[(3R)-3-(3,4-dimethoxyphenyl)-5-(2-hydroxynaphthalen-1-yl)-3,4-dihydropyrazol-2-yl]ethanone.
| Compound Name | 1-[(3R)-3-(3,4-dimethoxyphenyl)-5-(2-hydroxynaphthalen-1-yl)-3,4-dihydropyrazol-2-yl]ethanone |
|---|---|
| PubChem CID | 136690179 |
| Molecular Formula | C23H22N2O4 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | 1-[(3R)-3-(3,4-dimethoxyphenyl)-5-(2-hydroxynaphthalen-1-yl)-3,4-dihydropyrazol-2-yl]ethanone |
| SMILES | COc1ccc([C@H]2CC(c3c(O)ccc4ccccc34)=NN2C(C)=O)cc1OC |
| InChI | InChI=1S/C23H22N2O4/c1-14(26)25-19(16-9-11-21(28-2)22(12-16)29-3)13-18(24-25)23-17-7-5-4-6-15(17)8-10-20(23)27/h4-12,19,27H,13H2,1-3H3/t19-/m1/s1 |
| InChIKey | AJPOORVEBHHPGL-LJQANCHMSA-N |
| XLogP | 4.26 |
| TPSA | 71.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'} |
|---|