C24H20N2O2 — CID 1405659
(E)-1-[(3S)-5-(2-hydroxyphenyl)-3-phenyl-3,4-dihydropyrazol-2-yl]-3-phenylprop-2-en-1-one (PubChem CID 1405659) has the molecular formula C24H20N2O2 and a molecular weight of 368.44 g/mol. Its IUPAC name is (E)-1-[(3S)-5-(2-hydroxyphenyl)-3-phenyl-3,4-dihydropyrazol-2-yl]-3-phenylprop-2-en-1-one.
| Compound Name | (E)-1-[(3S)-5-(2-hydroxyphenyl)-3-phenyl-3,4-dihydropyrazol-2-yl]-3-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 1405659 |
| Molecular Formula | C24H20N2O2 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | (E)-1-[(3S)-5-(2-hydroxyphenyl)-3-phenyl-3,4-dihydropyrazol-2-yl]-3-phenylprop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccccc1)N1N=C(c2ccccc2O)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C24H20N2O2/c27-23-14-8-7-13-20(23)21-17-22(19-11-5-2-6-12-19)26(25-21)24(28)16-15-18-9-3-1-4-10-18/h1-16,22,27H,17H2/b16-15+/t22-/m0/s1 |
| InChIKey | ZOFJXBBLZXKSMK-BQXQKYNTSA-N |
| XLogP | 4.78 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|