C21H21BrN3O3- — CID 78429729
4-[5-(4-bromophenyl)-3-[4-(dimethylamino)phenyl]-3,4-dihydropyrazol-2-yl]-4-oxobutanoate (PubChem CID 78429729) has the molecular formula C21H21BrN3O3- and a molecular weight of 443.32 g/mol. Its IUPAC name is 4-[5-(4-bromophenyl)-3-[4-(dimethylamino)phenyl]-3,4-dihydropyrazol-2-yl]-4-oxobutanoate.
| Compound Name | 4-[5-(4-bromophenyl)-3-[4-(dimethylamino)phenyl]-3,4-dihydropyrazol-2-yl]-4-oxobutanoate |
|---|---|
| PubChem CID | 78429729 |
| Molecular Formula | C21H21BrN3O3- |
| Molecular Weight | 443.32 g/mol |
| Exact Mass | 442.08 |
| IUPAC Name | 4-[5-(4-bromophenyl)-3-[4-(dimethylamino)phenyl]-3,4-dihydropyrazol-2-yl]-4-oxobutanoate |
| SMILES | CN(C)c1ccc(C2CC(c3ccc(Br)cc3)=NN2C(=O)CCC(=O)[O-])cc1 |
| InChI | InChI=1S/C21H22BrN3O3/c1-24(2)17-9-5-15(6-10-17)19-13-18(14-3-7-16(22)8-4-14)23-25(19)20(26)11-12-21(27)28/h3-10,19H,11-13H2,1-2H3,(H,27,28)/p-1 |
| InChIKey | ORADGOBZYTVULL-UHFFFAOYSA-M |
| XLogP | 2.72 |
| TPSA | 76.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.32 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|