C26H25Br2N3O3S — CID 159791207
1-[5-[4-[(2,5-dibromophenyl)sulfonylmethyl]phenyl]-3-[4-(dimethylamino)phenyl]-3,4-dihydropyrazol-2-yl]ethanone (PubChem CID 159791207) has the molecular formula C26H25Br2N3O3S and a molecular weight of 619.38 g/mol. Its IUPAC name is 1-[5-[4-[(2,5-dibromophenyl)sulfonylmethyl]phenyl]-3-[4-(dimethylamino)phenyl]-3,4-dihydropyrazol-2-yl]ethanone.
| Compound Name | 1-[5-[4-[(2,5-dibromophenyl)sulfonylmethyl]phenyl]-3-[4-(dimethylamino)phenyl]-3,4-dihydropyrazol-2-yl]ethanone |
|---|---|
| PubChem CID | 159791207 |
| Molecular Formula | C26H25Br2N3O3S |
| Molecular Weight | 619.38 g/mol |
| Exact Mass | 617.00 |
| IUPAC Name | 1-[5-[4-[(2,5-dibromophenyl)sulfonylmethyl]phenyl]-3-[4-(dimethylamino)phenyl]-3,4-dihydropyrazol-2-yl]ethanone |
| SMILES | CC(=O)N1N=C(c2ccc(CS(=O)(=O)c3cc(Br)ccc3Br)cc2)CC1c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C26H25Br2N3O3S/c1-17(32)31-25(20-8-11-22(12-9-20)30(2)3)15-24(29-31)19-6-4-18(5-7-19)16-35(33,34)26-14-21(27)10-13-23(26)28/h4-14,25H,15-16H2,1-3H3 |
| InChIKey | NIOUAAZCYAOSRG-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 70.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.38 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|