C27H30ClN3O2S — CID 160504829
4-[5-[4-[(4-chlorophenyl)sulfonylmethyl]phenyl]-2-propan-2-yl-3,4-dihydropyrazol-3-yl]-N,N-dimethylaniline (PubChem CID 160504829) has the molecular formula C27H30ClN3O2S and a molecular weight of 496.08 g/mol. Its IUPAC name is 4-[5-[4-[(4-chlorophenyl)sulfonylmethyl]phenyl]-2-propan-2-yl-3,4-dihydropyrazol-3-yl]-N,N-dimethylaniline.
| Compound Name | 4-[5-[4-[(4-chlorophenyl)sulfonylmethyl]phenyl]-2-propan-2-yl-3,4-dihydropyrazol-3-yl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 160504829 |
| Molecular Formula | C27H30ClN3O2S |
| Molecular Weight | 496.08 g/mol |
| Exact Mass | 495.17 |
| IUPAC Name | 4-[5-[4-[(4-chlorophenyl)sulfonylmethyl]phenyl]-2-propan-2-yl-3,4-dihydropyrazol-3-yl]-N,N-dimethylaniline |
| SMILES | CC(C)N1N=C(c2ccc(CS(=O)(=O)c3ccc(Cl)cc3)cc2)CC1c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C27H30ClN3O2S/c1-19(2)31-27(22-9-13-24(14-10-22)30(3)4)17-26(29-31)21-7-5-20(6-8-21)18-34(32,33)25-15-11-23(28)12-16-25/h5-16,19,27H,17-18H2,1-4H3 |
| InChIKey | QSGKKTFOTRFDGY-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 52.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.08 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|