C23H31N5O2S — CID 164611636
N,N-dimethyl-4-[5-[4-(4-methylpiperazin-1-yl)phenyl]-2-methylsulfonyl-3,4-dihydropyrazol-3-yl]aniline (PubChem CID 164611636) has the molecular formula C23H31N5O2S and a molecular weight of 441.60 g/mol. Its IUPAC name is N,N-dimethyl-4-[5-[4-(4-methylpiperazin-1-yl)phenyl]-2-methylsulfonyl-3,4-dihydropyrazol-3-yl]aniline.
| Compound Name | N,N-dimethyl-4-[5-[4-(4-methylpiperazin-1-yl)phenyl]-2-methylsulfonyl-3,4-dihydropyrazol-3-yl]aniline |
|---|---|
| PubChem CID | 164611636 |
| Molecular Formula | C23H31N5O2S |
| Molecular Weight | 441.60 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | N,N-dimethyl-4-[5-[4-(4-methylpiperazin-1-yl)phenyl]-2-methylsulfonyl-3,4-dihydropyrazol-3-yl]aniline |
| SMILES | CN1CCN(c2ccc(C3=NN(S(C)(=O)=O)C(c4ccc(N(C)C)cc4)C3)cc2)CC1 |
| InChI | InChI=1S/C23H31N5O2S/c1-25(2)20-9-7-19(8-10-20)23-17-22(24-28(23)31(4,29)30)18-5-11-21(12-6-18)27-15-13-26(3)14-16-27/h5-12,23H,13-17H2,1-4H3 |
| InChIKey | ZGNDGWFVRMBYBY-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 59.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.60 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|