C24H21ClN3O2- — CID 7150383
4-[(3S)-5-(4-chlorophenyl)-3-[4-(dimethylamino)phenyl]-3,4-dihydropyrazol-2-yl]benzoate (PubChem CID 7150383) has the molecular formula C24H21ClN3O2- and a molecular weight of 418.90 g/mol. Its IUPAC name is 4-[(3S)-5-(4-chlorophenyl)-3-[4-(dimethylamino)phenyl]-3,4-dihydropyrazol-2-yl]benzoate.
| Compound Name | 4-[(3S)-5-(4-chlorophenyl)-3-[4-(dimethylamino)phenyl]-3,4-dihydropyrazol-2-yl]benzoate |
|---|---|
| PubChem CID | 7150383 |
| Molecular Formula | C24H21ClN3O2- |
| Molecular Weight | 418.90 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | 4-[(3S)-5-(4-chlorophenyl)-3-[4-(dimethylamino)phenyl]-3,4-dihydropyrazol-2-yl]benzoate |
| SMILES | CN(C)c1ccc([C@@H]2CC(c3ccc(Cl)cc3)=NN2c2ccc(C(=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C24H22ClN3O2/c1-27(2)20-11-5-17(6-12-20)23-15-22(16-3-9-19(25)10-4-16)26-28(23)21-13-7-18(8-14-21)24(29)30/h3-14,23H,15H2,1-2H3,(H,29,30)/p-1/t23-/m0/s1 |
| InChIKey | ILBXQRTYZFWXCR-QHCPKHFHSA-M |
| XLogP | 4.13 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.90 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|