C19H19Cl2N3O2 — CID 135503895
1-[5-(3,5-dichloro-2-hydroxyphenyl)-3-[4-(dimethylamino)phenyl]-3,4-dihydropyrazol-2-yl]ethanone (PubChem CID 135503895) has the molecular formula C19H19Cl2N3O2 and a molecular weight of 392.29 g/mol. Its IUPAC name is 1-[5-(3,5-dichloro-2-hydroxyphenyl)-3-[4-(dimethylamino)phenyl]-3,4-dihydropyrazol-2-yl]ethanone.
| Compound Name | 1-[5-(3,5-dichloro-2-hydroxyphenyl)-3-[4-(dimethylamino)phenyl]-3,4-dihydropyrazol-2-yl]ethanone |
|---|---|
| PubChem CID | 135503895 |
| Molecular Formula | C19H19Cl2N3O2 |
| Molecular Weight | 392.29 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | 1-[5-(3,5-dichloro-2-hydroxyphenyl)-3-[4-(dimethylamino)phenyl]-3,4-dihydropyrazol-2-yl]ethanone |
| SMILES | CC(=O)N1N=C(c2cc(Cl)cc(Cl)c2O)CC1c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C19H19Cl2N3O2/c1-11(25)24-18(12-4-6-14(7-5-12)23(2)3)10-17(22-24)15-8-13(20)9-16(21)19(15)26/h4-9,18,26H,10H2,1-3H3 |
| InChIKey | HIGWONCTUUPOMS-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 56.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.29 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|