C22H19BrN4O3S — CID 66488418
(5Z)-5-[2-[5-(4-bromophenyl)-3-[4-(dimethylamino)phenyl]-3,4-dihydropyrazol-2-yl]-2-oxoethylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 66488418) has the molecular formula C22H19BrN4O3S and a molecular weight of 499.39 g/mol. Its IUPAC name is (5Z)-5-[2-[5-(4-bromophenyl)-3-[4-(dimethylamino)phenyl]-3,4-dihydropyrazol-2-yl]-2-oxoethylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[2-[5-(4-bromophenyl)-3-[4-(dimethylamino)phenyl]-3,4-dihydropyrazol-2-yl]-2-oxoethylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 66488418 |
| Molecular Formula | C22H19BrN4O3S |
| Molecular Weight | 499.39 g/mol |
| Exact Mass | 498.04 |
| IUPAC Name | (5Z)-5-[2-[5-(4-bromophenyl)-3-[4-(dimethylamino)phenyl]-3,4-dihydropyrazol-2-yl]-2-oxoethylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CN(C)c1ccc(C2CC(c3ccc(Br)cc3)=NN2C(=O)/C=C2\SC(=O)NC2=O)cc1 |
| InChI | InChI=1S/C22H19BrN4O3S/c1-26(2)16-9-5-14(6-10-16)18-11-17(13-3-7-15(23)8-4-13)25-27(18)20(28)12-19-21(29)24-22(30)31-19/h3-10,12,18H,11H2,1-2H3,(H,24,29,30)/b19-12- |
| InChIKey | MXGJVUYMRSVKMH-UNOMPAQXSA-N |
| XLogP | 4.06 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.39 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|