C18H12ClN3O3S2 — CID 66488816
(5Z)-5-[2-[5-(2-chlorophenyl)-3-thiophen-2-yl-3,4-dihydropyrazol-2-yl]-2-oxoethylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 66488816) has the molecular formula C18H12ClN3O3S2 and a molecular weight of 417.90 g/mol. Its IUPAC name is (5Z)-5-[2-[5-(2-chlorophenyl)-3-thiophen-2-yl-3,4-dihydropyrazol-2-yl]-2-oxoethylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[2-[5-(2-chlorophenyl)-3-thiophen-2-yl-3,4-dihydropyrazol-2-yl]-2-oxoethylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 66488816 |
| Molecular Formula | C18H12ClN3O3S2 |
| Molecular Weight | 417.90 g/mol |
| Exact Mass | 417.00 |
| IUPAC Name | (5Z)-5-[2-[5-(2-chlorophenyl)-3-thiophen-2-yl-3,4-dihydropyrazol-2-yl]-2-oxoethylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)/C(=C/C(=O)N2N=C(c3ccccc3Cl)CC2c2cccs2)S1 |
| InChI | InChI=1S/C18H12ClN3O3S2/c19-11-5-2-1-4-10(11)12-8-13(14-6-3-7-26-14)22(21-12)16(23)9-15-17(24)20-18(25)27-15/h1-7,9,13H,8H2,(H,20,24,25)/b15-9- |
| InChIKey | UWNUFDCYLRQTDV-DHDCSXOGSA-N |
| XLogP | 3.95 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.90 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|