C22H16BrClN2O3S — CID 66488815
5-bromo-2-[2-[5-(2-chlorophenyl)-3-thiophen-2-yl-3,4-dihydropyrazol-2-yl]-2-oxoethoxy]benzaldehyde (PubChem CID 66488815) has the molecular formula C22H16BrClN2O3S and a molecular weight of 503.81 g/mol. Its IUPAC name is 5-bromo-2-[2-[5-(2-chlorophenyl)-3-thiophen-2-yl-3,4-dihydropyrazol-2-yl]-2-oxoethoxy]benzaldehyde.
| Compound Name | 5-bromo-2-[2-[5-(2-chlorophenyl)-3-thiophen-2-yl-3,4-dihydropyrazol-2-yl]-2-oxoethoxy]benzaldehyde |
|---|---|
| PubChem CID | 66488815 |
| Molecular Formula | C22H16BrClN2O3S |
| Molecular Weight | 503.81 g/mol |
| Exact Mass | 501.98 |
| IUPAC Name | 5-bromo-2-[2-[5-(2-chlorophenyl)-3-thiophen-2-yl-3,4-dihydropyrazol-2-yl]-2-oxoethoxy]benzaldehyde |
| SMILES | O=Cc1cc(Br)ccc1OCC(=O)N1N=C(c2ccccc2Cl)CC1c1cccs1 |
| InChI | InChI=1S/C22H16BrClN2O3S/c23-15-7-8-20(14(10-15)12-27)29-13-22(28)26-19(21-6-3-9-30-21)11-18(25-26)16-4-1-2-5-17(16)24/h1-10,12,19H,11,13H2 |
| InChIKey | AOBIRLVOKWIMAV-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.81 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|