C22H18N4O7S — CID 66488573
(5Z)-5-[2-[3-(3,4-dimethoxyphenyl)-5-(4-nitrophenyl)-3,4-dihydropyrazol-2-yl]-2-oxoethylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 66488573) has the molecular formula C22H18N4O7S and a molecular weight of 482.47 g/mol. Its IUPAC name is (5Z)-5-[2-[3-(3,4-dimethoxyphenyl)-5-(4-nitrophenyl)-3,4-dihydropyrazol-2-yl]-2-oxoethylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[2-[3-(3,4-dimethoxyphenyl)-5-(4-nitrophenyl)-3,4-dihydropyrazol-2-yl]-2-oxoethylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 66488573 |
| Molecular Formula | C22H18N4O7S |
| Molecular Weight | 482.47 g/mol |
| Exact Mass | 482.09 |
| IUPAC Name | (5Z)-5-[2-[3-(3,4-dimethoxyphenyl)-5-(4-nitrophenyl)-3,4-dihydropyrazol-2-yl]-2-oxoethylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | COc1ccc(C2CC(c3ccc([N+](=O)[O-])cc3)=NN2C(=O)/C=C2\SC(=O)NC2=O)cc1OC |
| InChI | InChI=1S/C22H18N4O7S/c1-32-17-8-5-13(9-18(17)33-2)16-10-15(12-3-6-14(7-4-12)26(30)31)24-25(16)20(27)11-19-21(28)23-22(29)34-19/h3-9,11,16H,10H2,1-2H3,(H,23,28,29)/b19-11- |
| InChIKey | UENYQLVYAKZTDW-ODLFYWEKSA-N |
| XLogP | 3.16 |
| TPSA | 140.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.47 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|