C19H18N4O7 — CID 16729240
2-[4-[2-carbamoyl-3-(4-nitrophenyl)-3,4-dihydropyrazol-5-yl]-2-methoxyphenoxy]acetic acid (PubChem CID 16729240) has the molecular formula C19H18N4O7 and a molecular weight of 414.37 g/mol. Its IUPAC name is 2-[4-[2-carbamoyl-3-(4-nitrophenyl)-3,4-dihydropyrazol-5-yl]-2-methoxyphenoxy]acetic acid.
| Compound Name | 2-[4-[2-carbamoyl-3-(4-nitrophenyl)-3,4-dihydropyrazol-5-yl]-2-methoxyphenoxy]acetic acid |
|---|---|
| PubChem CID | 16729240 |
| Molecular Formula | C19H18N4O7 |
| Molecular Weight | 414.37 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | 2-[4-[2-carbamoyl-3-(4-nitrophenyl)-3,4-dihydropyrazol-5-yl]-2-methoxyphenoxy]acetic acid |
| SMILES | COc1cc(C2=NN(C(N)=O)C(c3ccc([N+](=O)[O-])cc3)C2)ccc1OCC(=O)O |
| InChI | InChI=1S/C19H18N4O7/c1-29-17-8-12(4-7-16(17)30-10-18(24)25)14-9-15(22(21-14)19(20)26)11-2-5-13(6-3-11)23(27)28/h2-8,15H,9-10H2,1H3,(H2,20,26)(H,24,25) |
| InChIKey | AUZHNSJTZKSTRS-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 157.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.37 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|