C23H19BrN2O2 — CID 136822558
[(3S)-3-(4-bromophenyl)-5-(2-hydroxyphenyl)-3,4-dihydropyrazol-2-yl]-(4-methylphenyl)methanone (PubChem CID 136822558) has the molecular formula C23H19BrN2O2 and a molecular weight of 435.32 g/mol. Its IUPAC name is [(3S)-3-(4-bromophenyl)-5-(2-hydroxyphenyl)-3,4-dihydropyrazol-2-yl]-(4-methylphenyl)methanone.
| Compound Name | [(3S)-3-(4-bromophenyl)-5-(2-hydroxyphenyl)-3,4-dihydropyrazol-2-yl]-(4-methylphenyl)methanone |
|---|---|
| PubChem CID | 136822558 |
| Molecular Formula | C23H19BrN2O2 |
| Molecular Weight | 435.32 g/mol |
| Exact Mass | 434.06 |
| IUPAC Name | [(3S)-3-(4-bromophenyl)-5-(2-hydroxyphenyl)-3,4-dihydropyrazol-2-yl]-(4-methylphenyl)methanone |
| SMILES | Cc1ccc(C(=O)N2N=C(c3ccccc3O)C[C@H]2c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C23H19BrN2O2/c1-15-6-8-17(9-7-15)23(28)26-21(16-10-12-18(24)13-11-16)14-20(25-26)19-4-2-3-5-22(19)27/h2-13,21,27H,14H2,1H3/t21-/m0/s1 |
| InChIKey | XOTOGPQEHVVJLC-NRFANRHFSA-N |
| XLogP | 5.45 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.32 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'} |
|---|