C26H23N3O6 — CID 25390645
[2-[(3R)-3-(4-methoxyphenyl)-5-phenyl-3,4-dihydropyrazol-2-yl]-2-oxoethyl] 2-(4-nitrophenyl)acetate (PubChem CID 25390645) has the molecular formula C26H23N3O6 and a molecular weight of 473.49 g/mol. Its IUPAC name is [2-[(3R)-3-(4-methoxyphenyl)-5-phenyl-3,4-dihydropyrazol-2-yl]-2-oxoethyl] 2-(4-nitrophenyl)acetate.
| Compound Name | [2-[(3R)-3-(4-methoxyphenyl)-5-phenyl-3,4-dihydropyrazol-2-yl]-2-oxoethyl] 2-(4-nitrophenyl)acetate |
|---|---|
| PubChem CID | 25390645 |
| Molecular Formula | C26H23N3O6 |
| Molecular Weight | 473.49 g/mol |
| Exact Mass | 473.16 |
| IUPAC Name | [2-[(3R)-3-(4-methoxyphenyl)-5-phenyl-3,4-dihydropyrazol-2-yl]-2-oxoethyl] 2-(4-nitrophenyl)acetate |
| SMILES | COc1ccc([C@H]2CC(c3ccccc3)=NN2C(=O)COC(=O)Cc2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C26H23N3O6/c1-34-22-13-9-20(10-14-22)24-16-23(19-5-3-2-4-6-19)27-28(24)25(30)17-35-26(31)15-18-7-11-21(12-8-18)29(32)33/h2-14,24H,15-17H2,1H3/t24-/m1/s1 |
| InChIKey | IBLBQEODJSRCFV-XMMPIXPASA-N |
| XLogP | 4.07 |
| TPSA | 111.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.49 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|