C30H24N4O8 — CID 23762803
[2-[3-(4-methoxyphenyl)-5-naphthalen-2-yl-3,4-dihydropyrazol-2-yl]-2-oxoethyl] 2-(2,4-dinitrophenyl)acetate (PubChem CID 23762803) has the molecular formula C30H24N4O8 and a molecular weight of 568.54 g/mol. Its IUPAC name is [2-[3-(4-methoxyphenyl)-5-naphthalen-2-yl-3,4-dihydropyrazol-2-yl]-2-oxoethyl] 2-(2,4-dinitrophenyl)acetate.
| Compound Name | [2-[3-(4-methoxyphenyl)-5-naphthalen-2-yl-3,4-dihydropyrazol-2-yl]-2-oxoethyl] 2-(2,4-dinitrophenyl)acetate |
|---|---|
| PubChem CID | 23762803 |
| Molecular Formula | C30H24N4O8 |
| Molecular Weight | 568.54 g/mol |
| Exact Mass | 568.16 |
| IUPAC Name | [2-[3-(4-methoxyphenyl)-5-naphthalen-2-yl-3,4-dihydropyrazol-2-yl]-2-oxoethyl] 2-(2,4-dinitrophenyl)acetate |
| SMILES | COc1ccc(C2CC(c3ccc4ccccc4c3)=NN2C(=O)COC(=O)Cc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C30H24N4O8/c1-41-25-12-9-20(10-13-25)27-17-26(22-7-6-19-4-2-3-5-21(19)14-22)31-32(27)29(35)18-42-30(36)15-23-8-11-24(33(37)38)16-28(23)34(39)40/h2-14,16,27H,15,17-18H2,1H3 |
| InChIKey | DXWVQJIDCLIBEH-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 154.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.54 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|