C26H23N3O7 — CID 42963097
[2-[3-(4-methoxyphenyl)-5-phenyl-3,4-dihydropyrazol-2-yl]-2-oxoethyl] 2-(2-nitrophenoxy)acetate (PubChem CID 42963097) has the molecular formula C26H23N3O7 and a molecular weight of 489.48 g/mol. Its IUPAC name is [2-[3-(4-methoxyphenyl)-5-phenyl-3,4-dihydropyrazol-2-yl]-2-oxoethyl] 2-(2-nitrophenoxy)acetate.
| Compound Name | [2-[3-(4-methoxyphenyl)-5-phenyl-3,4-dihydropyrazol-2-yl]-2-oxoethyl] 2-(2-nitrophenoxy)acetate |
|---|---|
| PubChem CID | 42963097 |
| Molecular Formula | C26H23N3O7 |
| Molecular Weight | 489.48 g/mol |
| Exact Mass | 489.15 |
| IUPAC Name | [2-[3-(4-methoxyphenyl)-5-phenyl-3,4-dihydropyrazol-2-yl]-2-oxoethyl] 2-(2-nitrophenoxy)acetate |
| SMILES | COc1ccc(C2CC(c3ccccc3)=NN2C(=O)COC(=O)COc2ccccc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C26H23N3O7/c1-34-20-13-11-19(12-14-20)23-15-21(18-7-3-2-4-8-18)27-28(23)25(30)16-36-26(31)17-35-24-10-6-5-9-22(24)29(32)33/h2-14,23H,15-17H2,1H3 |
| InChIKey | DATSFCGUOLTYQD-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 120.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.48 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|