C26H21N3O3S — CID 11547010
5-(4-methylsulfanylphenyl)-3-[5-(4-nitrophenyl)furan-2-yl]-2-phenyl-3,4-dihydropyrazole (PubChem CID 11547010) has the molecular formula C26H21N3O3S and a molecular weight of 455.54 g/mol. Its IUPAC name is 5-(4-methylsulfanylphenyl)-3-[5-(4-nitrophenyl)furan-2-yl]-2-phenyl-3,4-dihydropyrazole.
| Compound Name | 5-(4-methylsulfanylphenyl)-3-[5-(4-nitrophenyl)furan-2-yl]-2-phenyl-3,4-dihydropyrazole |
|---|---|
| PubChem CID | 11547010 |
| Molecular Formula | C26H21N3O3S |
| Molecular Weight | 455.54 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | 5-(4-methylsulfanylphenyl)-3-[5-(4-nitrophenyl)furan-2-yl]-2-phenyl-3,4-dihydropyrazole |
| SMILES | CSc1ccc(C2=NN(c3ccccc3)C(c3ccc(-c4ccc([N+](=O)[O-])cc4)o3)C2)cc1 |
| InChI | InChI=1S/C26H21N3O3S/c1-33-22-13-9-18(10-14-22)23-17-24(28(27-23)20-5-3-2-4-6-20)26-16-15-25(32-26)19-7-11-21(12-8-19)29(30)31/h2-16,24H,17H2,1H3 |
| InChIKey | PQWZUSFBRFFFBQ-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 71.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.54 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|