C21H21N5O3 — CID 53491313
3-[2-(4-nitrophenyl)-3-(1,3,5-trimethylpyrazol-4-yl)-3,4-dihydropyrazol-5-yl]phenol (PubChem CID 53491313) has the molecular formula C21H21N5O3 and a molecular weight of 391.43 g/mol. Its IUPAC name is 3-[2-(4-nitrophenyl)-3-(1,3,5-trimethylpyrazol-4-yl)-3,4-dihydropyrazol-5-yl]phenol.
| Compound Name | 3-[2-(4-nitrophenyl)-3-(1,3,5-trimethylpyrazol-4-yl)-3,4-dihydropyrazol-5-yl]phenol |
|---|---|
| PubChem CID | 53491313 |
| Molecular Formula | C21H21N5O3 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | 3-[2-(4-nitrophenyl)-3-(1,3,5-trimethylpyrazol-4-yl)-3,4-dihydropyrazol-5-yl]phenol |
| SMILES | Cc1nn(C)c(C)c1C1CC(c2cccc(O)c2)=NN1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H21N5O3/c1-13-21(14(2)24(3)22-13)20-12-19(15-5-4-6-18(27)11-15)23-25(20)16-7-9-17(10-8-16)26(28)29/h4-11,20,27H,12H2,1-3H3 |
| InChIKey | GRVKQXZVPPKUES-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 96.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|