C31H25N5 — CID 40907039
N-[(Z)-[4-[(3R)-3,5-diphenyl-3,4-dihydropyrazol-2-yl]phenyl]methylideneamino]quinolin-8-amine (PubChem CID 40907039) has the molecular formula C31H25N5 and a molecular weight of 467.58 g/mol. Its IUPAC name is N-[(Z)-[4-[(3R)-3,5-diphenyl-3,4-dihydropyrazol-2-yl]phenyl]methylideneamino]quinolin-8-amine.
| Compound Name | N-[(Z)-[4-[(3R)-3,5-diphenyl-3,4-dihydropyrazol-2-yl]phenyl]methylideneamino]quinolin-8-amine |
|---|---|
| PubChem CID | 40907039 |
| Molecular Formula | C31H25N5 |
| Molecular Weight | 467.58 g/mol |
| Exact Mass | 467.21 |
| IUPAC Name | N-[(Z)-[4-[(3R)-3,5-diphenyl-3,4-dihydropyrazol-2-yl]phenyl]methylideneamino]quinolin-8-amine |
| SMILES | C(=N\Nc1cccc2cccnc12)\c1ccc(N2N=C(c3ccccc3)C[C@@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C31H25N5/c1-3-9-24(10-4-1)29-21-30(25-11-5-2-6-12-25)36(35-29)27-18-16-23(17-19-27)22-33-34-28-15-7-13-26-14-8-20-32-31(26)28/h1-20,22,30,34H,21H2/b33-22-/t30-/m1/s1 |
| InChIKey | VYHKOMSJIOLONK-CGTVSLCZSA-N |
| XLogP | 7.04 |
| TPSA | 52.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.58 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|