C22H18N4O3 — CID 5219958
N-[[4-(1,3-dihydroisoindol-2-yl)phenyl]methylideneamino]-4-nitrobenzamide (PubChem CID 5219958) has the molecular formula C22H18N4O3 and a molecular weight of 386.41 g/mol. Its IUPAC name is N-[[4-(1,3-dihydroisoindol-2-yl)phenyl]methylideneamino]-4-nitrobenzamide.
| Compound Name | N-[[4-(1,3-dihydroisoindol-2-yl)phenyl]methylideneamino]-4-nitrobenzamide |
|---|---|
| PubChem CID | 5219958 |
| Molecular Formula | C22H18N4O3 |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | N-[[4-(1,3-dihydroisoindol-2-yl)phenyl]methylideneamino]-4-nitrobenzamide |
| SMILES | O=C(NN=Cc1ccc(N2Cc3ccccc3C2)cc1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H18N4O3/c27-22(17-7-11-21(12-8-17)26(28)29)24-23-13-16-5-9-20(10-6-16)25-14-18-3-1-2-4-19(18)15-25/h1-13H,14-15H2,(H,24,27) |
| InChIKey | TZDMTQGQAZSFTQ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 87.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|