C30H22ClN3 — CID 3445126
2-(4-chlorophenyl)-3-[4-(3,5-diphenyl-3,4-dihydropyrazol-2-yl)phenyl]prop-2-enenitrile (PubChem CID 3445126) has the molecular formula C30H22ClN3 and a molecular weight of 459.98 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-3-[4-(3,5-diphenyl-3,4-dihydropyrazol-2-yl)phenyl]prop-2-enenitrile.
| Compound Name | 2-(4-chlorophenyl)-3-[4-(3,5-diphenyl-3,4-dihydropyrazol-2-yl)phenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 3445126 |
| Molecular Formula | C30H22ClN3 |
| Molecular Weight | 459.98 g/mol |
| Exact Mass | 459.15 |
| IUPAC Name | 2-(4-chlorophenyl)-3-[4-(3,5-diphenyl-3,4-dihydropyrazol-2-yl)phenyl]prop-2-enenitrile |
| SMILES | N#CC(=Cc1ccc(N2N=C(c3ccccc3)CC2c2ccccc2)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C30H22ClN3/c31-27-15-13-23(14-16-27)26(21-32)19-22-11-17-28(18-12-22)34-30(25-9-5-2-6-10-25)20-29(33-34)24-7-3-1-4-8-24/h1-19,30H,20H2 |
| InChIKey | FJSJHSRGDQOSMQ-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 39.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.98 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|