C34H23ClN2O2 — CID 3444937
1-[5-(2-chlorophenyl)furan-2-yl]-3-[4-(3,5-diphenylpyrazol-1-yl)phenyl]prop-2-en-1-one (PubChem CID 3444937) has the molecular formula C34H23ClN2O2 and a molecular weight of 527.02 g/mol. Its IUPAC name is 1-[5-(2-chlorophenyl)furan-2-yl]-3-[4-(3,5-diphenylpyrazol-1-yl)phenyl]prop-2-en-1-one.
| Compound Name | 1-[5-(2-chlorophenyl)furan-2-yl]-3-[4-(3,5-diphenylpyrazol-1-yl)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 3444937 |
| Molecular Formula | C34H23ClN2O2 |
| Molecular Weight | 527.02 g/mol |
| Exact Mass | 526.14 |
| IUPAC Name | 1-[5-(2-chlorophenyl)furan-2-yl]-3-[4-(3,5-diphenylpyrazol-1-yl)phenyl]prop-2-en-1-one |
| SMILES | O=C(C=Cc1ccc(-n2nc(-c3ccccc3)cc2-c2ccccc2)cc1)c1ccc(-c2ccccc2Cl)o1 |
| InChI | InChI=1S/C34H23ClN2O2/c35-29-14-8-7-13-28(29)33-21-22-34(39-33)32(38)20-17-24-15-18-27(19-16-24)37-31(26-11-5-2-6-12-26)23-30(36-37)25-9-3-1-4-10-25/h1-23H |
| InChIKey | OGSZPWJJPNFUSP-UHFFFAOYSA-N |
| XLogP | 9.02 |
| TPSA | 48.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.02 |
| LogP ≤ 5 | 9.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|