C28H17Cl3N2O2 — CID 4014112
3-[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]-1-[5-(2,4-dichlorophenyl)furan-2-yl]prop-2-en-1-one (PubChem CID 4014112) has the molecular formula C28H17Cl3N2O2 and a molecular weight of 519.82 g/mol. Its IUPAC name is 3-[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]-1-[5-(2,4-dichlorophenyl)furan-2-yl]prop-2-en-1-one.
| Compound Name | 3-[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]-1-[5-(2,4-dichlorophenyl)furan-2-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 4014112 |
| Molecular Formula | C28H17Cl3N2O2 |
| Molecular Weight | 519.82 g/mol |
| Exact Mass | 518.04 |
| IUPAC Name | 3-[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]-1-[5-(2,4-dichlorophenyl)furan-2-yl]prop-2-en-1-one |
| SMILES | O=C(C=Cc1cn(-c2ccccc2)nc1-c1ccc(Cl)cc1)c1ccc(-c2ccc(Cl)cc2Cl)o1 |
| InChI | InChI=1S/C28H17Cl3N2O2/c29-20-9-6-18(7-10-20)28-19(17-33(32-28)22-4-2-1-3-5-22)8-13-25(34)27-15-14-26(35-27)23-12-11-21(30)16-24(23)31/h1-17H |
| InChIKey | RAANMXAETHLXSE-UHFFFAOYSA-N |
| XLogP | 8.66 |
| TPSA | 48.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.82 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|