C28H18Cl2N2O2 — CID 4704593
1-[5-(2,5-dichlorophenyl)furan-2-yl]-3-(1,3-diphenylpyrazol-4-yl)prop-2-en-1-one (PubChem CID 4704593) has the molecular formula C28H18Cl2N2O2 and a molecular weight of 485.37 g/mol. Its IUPAC name is 1-[5-(2,5-dichlorophenyl)furan-2-yl]-3-(1,3-diphenylpyrazol-4-yl)prop-2-en-1-one.
| Compound Name | 1-[5-(2,5-dichlorophenyl)furan-2-yl]-3-(1,3-diphenylpyrazol-4-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 4704593 |
| Molecular Formula | C28H18Cl2N2O2 |
| Molecular Weight | 485.37 g/mol |
| Exact Mass | 484.07 |
| IUPAC Name | 1-[5-(2,5-dichlorophenyl)furan-2-yl]-3-(1,3-diphenylpyrazol-4-yl)prop-2-en-1-one |
| SMILES | O=C(C=Cc1cn(-c2ccccc2)nc1-c1ccccc1)c1ccc(-c2cc(Cl)ccc2Cl)o1 |
| InChI | InChI=1S/C28H18Cl2N2O2/c29-21-12-13-24(30)23(17-21)26-15-16-27(34-26)25(33)14-11-20-18-32(22-9-5-2-6-10-22)31-28(20)19-7-3-1-4-8-19/h1-18H |
| InChIKey | XFNCUSSKPFOQCK-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 48.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.37 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|