C23H13Cl2NO5 — CID 3283792
1-[5-(2,5-dichlorophenyl)furan-2-yl]-3-[5-(3-nitrophenyl)furan-2-yl]prop-2-en-1-one (PubChem CID 3283792) has the molecular formula C23H13Cl2NO5 and a molecular weight of 454.27 g/mol. Its IUPAC name is 1-[5-(2,5-dichlorophenyl)furan-2-yl]-3-[5-(3-nitrophenyl)furan-2-yl]prop-2-en-1-one.
| Compound Name | 1-[5-(2,5-dichlorophenyl)furan-2-yl]-3-[5-(3-nitrophenyl)furan-2-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 3283792 |
| Molecular Formula | C23H13Cl2NO5 |
| Molecular Weight | 454.27 g/mol |
| Exact Mass | 453.02 |
| IUPAC Name | 1-[5-(2,5-dichlorophenyl)furan-2-yl]-3-[5-(3-nitrophenyl)furan-2-yl]prop-2-en-1-one |
| SMILES | O=C(C=Cc1ccc(-c2cccc([N+](=O)[O-])c2)o1)c1ccc(-c2cc(Cl)ccc2Cl)o1 |
| InChI | InChI=1S/C23H13Cl2NO5/c24-15-4-7-19(25)18(13-15)22-10-11-23(31-22)20(27)8-5-17-6-9-21(30-17)14-2-1-3-16(12-14)26(28)29/h1-13H |
| InChIKey | PFPUEUAVZJLSSN-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 86.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.27 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|