C19H11Cl2NO4 — CID 4736214
3-[5-(2,5-dichlorophenyl)furan-2-yl]-1-(3-nitrophenyl)prop-2-en-1-one (PubChem CID 4736214) has the molecular formula C19H11Cl2NO4 and a molecular weight of 388.21 g/mol. Its IUPAC name is 3-[5-(2,5-dichlorophenyl)furan-2-yl]-1-(3-nitrophenyl)prop-2-en-1-one.
| Compound Name | 3-[5-(2,5-dichlorophenyl)furan-2-yl]-1-(3-nitrophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 4736214 |
| Molecular Formula | C19H11Cl2NO4 |
| Molecular Weight | 388.21 g/mol |
| Exact Mass | 387.01 |
| IUPAC Name | 3-[5-(2,5-dichlorophenyl)furan-2-yl]-1-(3-nitrophenyl)prop-2-en-1-one |
| SMILES | O=C(C=Cc1ccc(-c2cc(Cl)ccc2Cl)o1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H11Cl2NO4/c20-13-4-7-17(21)16(11-13)19-9-6-15(26-19)5-8-18(23)12-2-1-3-14(10-12)22(24)25/h1-11H |
| InChIKey | XVPLBFVFVMSQHB-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 73.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.21 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|