C24H15Cl2NO4 — CID 4736219
N-[4-[3-[5-(2,5-dichlorophenyl)furan-2-yl]prop-2-enoyl]phenyl]furan-2-carboxamide (PubChem CID 4736219) has the molecular formula C24H15Cl2NO4 and a molecular weight of 452.29 g/mol. Its IUPAC name is N-[4-[3-[5-(2,5-dichlorophenyl)furan-2-yl]prop-2-enoyl]phenyl]furan-2-carboxamide.
| Compound Name | N-[4-[3-[5-(2,5-dichlorophenyl)furan-2-yl]prop-2-enoyl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 4736219 |
| Molecular Formula | C24H15Cl2NO4 |
| Molecular Weight | 452.29 g/mol |
| Exact Mass | 451.04 |
| IUPAC Name | N-[4-[3-[5-(2,5-dichlorophenyl)furan-2-yl]prop-2-enoyl]phenyl]furan-2-carboxamide |
| SMILES | O=C(C=Cc1ccc(-c2cc(Cl)ccc2Cl)o1)c1ccc(NC(=O)c2ccco2)cc1 |
| InChI | InChI=1S/C24H15Cl2NO4/c25-16-5-10-20(26)19(14-16)22-12-9-18(31-22)8-11-21(28)15-3-6-17(7-4-15)27-24(29)23-2-1-13-30-23/h1-14H,(H,27,29) |
| InChIKey | UBCODZOOZLPMHM-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 72.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.29 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|