C25H18Cl2N2O4 — CID 17313609
N-[3-[[(E)-3-[5-(2,3-dichlorophenyl)furan-2-yl]prop-2-enoyl]amino]-4-methylphenyl]furan-2-carboxamide (PubChem CID 17313609) has the molecular formula C25H18Cl2N2O4 and a molecular weight of 481.34 g/mol. Its IUPAC name is N-[3-[[(E)-3-[5-(2,3-dichlorophenyl)furan-2-yl]prop-2-enoyl]amino]-4-methylphenyl]furan-2-carboxamide.
| Compound Name | N-[3-[[(E)-3-[5-(2,3-dichlorophenyl)furan-2-yl]prop-2-enoyl]amino]-4-methylphenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 17313609 |
| Molecular Formula | C25H18Cl2N2O4 |
| Molecular Weight | 481.34 g/mol |
| Exact Mass | 480.06 |
| IUPAC Name | N-[3-[[(E)-3-[5-(2,3-dichlorophenyl)furan-2-yl]prop-2-enoyl]amino]-4-methylphenyl]furan-2-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2ccco2)cc1NC(=O)/C=C/c1ccc(-c2cccc(Cl)c2Cl)o1 |
| InChI | InChI=1S/C25H18Cl2N2O4/c1-15-7-8-16(28-25(31)22-6-3-13-32-22)14-20(15)29-23(30)12-10-17-9-11-21(33-17)18-4-2-5-19(26)24(18)27/h2-14H,1H3,(H,28,31)(H,29,30)/b12-10+ |
| InChIKey | STRAGFHTCVNBCU-ZRDIBKRKSA-N |
| XLogP | 7.06 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.34 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|