C21H16ClNO4 — CID 28686356
3-[[(E)-3-[5-(2-chlorophenyl)furan-2-yl]prop-2-enoyl]amino]-4-methylbenzoic acid (PubChem CID 28686356) has the molecular formula C21H16ClNO4 and a molecular weight of 381.82 g/mol. Its IUPAC name is 3-[[(E)-3-[5-(2-chlorophenyl)furan-2-yl]prop-2-enoyl]amino]-4-methylbenzoic acid.
| Compound Name | 3-[[(E)-3-[5-(2-chlorophenyl)furan-2-yl]prop-2-enoyl]amino]-4-methylbenzoic acid |
|---|---|
| PubChem CID | 28686356 |
| Molecular Formula | C21H16ClNO4 |
| Molecular Weight | 381.82 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | 3-[[(E)-3-[5-(2-chlorophenyl)furan-2-yl]prop-2-enoyl]amino]-4-methylbenzoic acid |
| SMILES | Cc1ccc(C(=O)O)cc1NC(=O)/C=C/c1ccc(-c2ccccc2Cl)o1 |
| InChI | InChI=1S/C21H16ClNO4/c1-13-6-7-14(21(25)26)12-18(13)23-20(24)11-9-15-8-10-19(27-15)16-4-2-3-5-17(16)22/h2-12H,1H3,(H,23,24)(H,25,26)/b11-9+ |
| InChIKey | ZMTXAQFEAZQGSK-PKNBQFBNSA-N |
| XLogP | 5.26 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.82 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|