C21H16ClNO5 — CID 28686358
3-[[(E)-3-[5-(2-chlorophenyl)furan-2-yl]prop-2-enoyl]amino]-4-methoxybenzoic acid (PubChem CID 28686358) has the molecular formula C21H16ClNO5 and a molecular weight of 397.81 g/mol. Its IUPAC name is 3-[[(E)-3-[5-(2-chlorophenyl)furan-2-yl]prop-2-enoyl]amino]-4-methoxybenzoic acid.
| Compound Name | 3-[[(E)-3-[5-(2-chlorophenyl)furan-2-yl]prop-2-enoyl]amino]-4-methoxybenzoic acid |
|---|---|
| PubChem CID | 28686358 |
| Molecular Formula | C21H16ClNO5 |
| Molecular Weight | 397.81 g/mol |
| Exact Mass | 397.07 |
| IUPAC Name | 3-[[(E)-3-[5-(2-chlorophenyl)furan-2-yl]prop-2-enoyl]amino]-4-methoxybenzoic acid |
| SMILES | COc1ccc(C(=O)O)cc1NC(=O)/C=C/c1ccc(-c2ccccc2Cl)o1 |
| InChI | InChI=1S/C21H16ClNO5/c1-27-19-9-6-13(21(25)26)12-17(19)23-20(24)11-8-14-7-10-18(28-14)15-4-2-3-5-16(15)22/h2-12H,1H3,(H,23,24)(H,25,26)/b11-8+ |
| InChIKey | VUSLQGKEIYYECV-DHZHZOJOSA-N |
| XLogP | 4.96 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.81 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|