C29H19Cl2NO5 — CID 4311631
3-[5-(2,3-dichlorophenyl)furan-2-yl]-N-[2-methoxy-5-(2-oxochromen-3-yl)phenyl]prop-2-enamide (PubChem CID 4311631) has the molecular formula C29H19Cl2NO5 and a molecular weight of 532.38 g/mol. Its IUPAC name is 3-[5-(2,3-dichlorophenyl)furan-2-yl]-N-[2-methoxy-5-(2-oxochromen-3-yl)phenyl]prop-2-enamide.
| Compound Name | 3-[5-(2,3-dichlorophenyl)furan-2-yl]-N-[2-methoxy-5-(2-oxochromen-3-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 4311631 |
| Molecular Formula | C29H19Cl2NO5 |
| Molecular Weight | 532.38 g/mol |
| Exact Mass | 531.06 |
| IUPAC Name | 3-[5-(2,3-dichlorophenyl)furan-2-yl]-N-[2-methoxy-5-(2-oxochromen-3-yl)phenyl]prop-2-enamide |
| SMILES | COc1ccc(-c2cc3ccccc3oc2=O)cc1NC(=O)C=Cc1ccc(-c2cccc(Cl)c2Cl)o1 |
| InChI | InChI=1S/C29H19Cl2NO5/c1-35-26-12-9-17(21-15-18-5-2-3-8-24(18)37-29(21)34)16-23(26)32-27(33)14-11-19-10-13-25(36-19)20-6-4-7-22(30)28(20)31/h2-16H,1H3,(H,32,33) |
| InChIKey | YIXSQEMHEHRLFV-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 81.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.38 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|