C22H18Cl2N2O4S — CID 3646960
3-[5-(2,3-dichlorophenyl)furan-2-yl]-N-[(2,4-dimethoxyphenyl)carbamothioyl]prop-2-enamide (PubChem CID 3646960) has the molecular formula C22H18Cl2N2O4S and a molecular weight of 477.37 g/mol. Its IUPAC name is 3-[5-(2,3-dichlorophenyl)furan-2-yl]-N-[(2,4-dimethoxyphenyl)carbamothioyl]prop-2-enamide.
| Compound Name | 3-[5-(2,3-dichlorophenyl)furan-2-yl]-N-[(2,4-dimethoxyphenyl)carbamothioyl]prop-2-enamide |
|---|---|
| PubChem CID | 3646960 |
| Molecular Formula | C22H18Cl2N2O4S |
| Molecular Weight | 477.37 g/mol |
| Exact Mass | 476.04 |
| IUPAC Name | 3-[5-(2,3-dichlorophenyl)furan-2-yl]-N-[(2,4-dimethoxyphenyl)carbamothioyl]prop-2-enamide |
| SMILES | COc1ccc(NC(=S)NC(=O)C=Cc2ccc(-c3cccc(Cl)c3Cl)o2)c(OC)c1 |
| InChI | InChI=1S/C22H18Cl2N2O4S/c1-28-14-6-9-17(19(12-14)29-2)25-22(31)26-20(27)11-8-13-7-10-18(30-13)15-4-3-5-16(23)21(15)24/h3-12H,1-2H3,(H2,25,26,27,31) |
| InChIKey | FQKHARHVQNODKU-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 72.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.37 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|