C26H18Cl2N2O2S — CID 5217579
3-[5-(2,3-dichlorophenyl)furan-2-yl]-N-(1,2-dihydroacenaphthylen-5-ylcarbamothioyl)prop-2-enamide (PubChem CID 5217579) has the molecular formula C26H18Cl2N2O2S and a molecular weight of 493.42 g/mol. Its IUPAC name is 3-[5-(2,3-dichlorophenyl)furan-2-yl]-N-(1,2-dihydroacenaphthylen-5-ylcarbamothioyl)prop-2-enamide.
| Compound Name | 3-[5-(2,3-dichlorophenyl)furan-2-yl]-N-(1,2-dihydroacenaphthylen-5-ylcarbamothioyl)prop-2-enamide |
|---|---|
| PubChem CID | 5217579 |
| Molecular Formula | C26H18Cl2N2O2S |
| Molecular Weight | 493.42 g/mol |
| Exact Mass | 492.05 |
| IUPAC Name | 3-[5-(2,3-dichlorophenyl)furan-2-yl]-N-(1,2-dihydroacenaphthylen-5-ylcarbamothioyl)prop-2-enamide |
| SMILES | O=C(C=Cc1ccc(-c2cccc(Cl)c2Cl)o1)NC(=S)Nc1ccc2c3c(cccc13)CC2 |
| InChI | InChI=1S/C26H18Cl2N2O2S/c27-20-6-2-5-19(25(20)28)22-13-10-17(32-22)11-14-23(31)30-26(33)29-21-12-9-16-8-7-15-3-1-4-18(21)24(15)16/h1-6,9-14H,7-8H2,(H2,29,30,31,33) |
| InChIKey | CLGXKNFYUWBHPL-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.42 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|