C23H20Cl2N2O3S — CID 3681523
3-[5-(2,3-dichlorophenyl)furan-2-yl]-N-[(2-hydroxy-5-propan-2-ylphenyl)carbamothioyl]prop-2-enamide (PubChem CID 3681523) has the molecular formula C23H20Cl2N2O3S and a molecular weight of 475.40 g/mol. Its IUPAC name is 3-[5-(2,3-dichlorophenyl)furan-2-yl]-N-[(2-hydroxy-5-propan-2-ylphenyl)carbamothioyl]prop-2-enamide.
| Compound Name | 3-[5-(2,3-dichlorophenyl)furan-2-yl]-N-[(2-hydroxy-5-propan-2-ylphenyl)carbamothioyl]prop-2-enamide |
|---|---|
| PubChem CID | 3681523 |
| Molecular Formula | C23H20Cl2N2O3S |
| Molecular Weight | 475.40 g/mol |
| Exact Mass | 474.06 |
| IUPAC Name | 3-[5-(2,3-dichlorophenyl)furan-2-yl]-N-[(2-hydroxy-5-propan-2-ylphenyl)carbamothioyl]prop-2-enamide |
| SMILES | CC(C)c1ccc(O)c(NC(=S)NC(=O)C=Cc2ccc(-c3cccc(Cl)c3Cl)o2)c1 |
| InChI | InChI=1S/C23H20Cl2N2O3S/c1-13(2)14-6-9-19(28)18(12-14)26-23(31)27-21(29)11-8-15-7-10-20(30-15)16-4-3-5-17(24)22(16)25/h3-13,28H,1-2H3,(H2,26,27,29,31) |
| InChIKey | IKXFUDVPESPHOM-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 74.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.40 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|