C20H16Cl2N4O2S — CID 17103606
(E)-3-[5-(2,3-dichlorophenyl)furan-2-yl]-N-[(4,6-dimethylpyrimidin-2-yl)carbamothioyl]prop-2-enamide (PubChem CID 17103606) has the molecular formula C20H16Cl2N4O2S and a molecular weight of 447.35 g/mol. Its IUPAC name is (E)-3-[5-(2,3-dichlorophenyl)furan-2-yl]-N-[(4,6-dimethylpyrimidin-2-yl)carbamothioyl]prop-2-enamide.
| Compound Name | (E)-3-[5-(2,3-dichlorophenyl)furan-2-yl]-N-[(4,6-dimethylpyrimidin-2-yl)carbamothioyl]prop-2-enamide |
|---|---|
| PubChem CID | 17103606 |
| Molecular Formula | C20H16Cl2N4O2S |
| Molecular Weight | 447.35 g/mol |
| Exact Mass | 446.04 |
| IUPAC Name | (E)-3-[5-(2,3-dichlorophenyl)furan-2-yl]-N-[(4,6-dimethylpyrimidin-2-yl)carbamothioyl]prop-2-enamide |
| SMILES | Cc1cc(C)nc(NC(=S)NC(=O)/C=C/c2ccc(-c3cccc(Cl)c3Cl)o2)n1 |
| InChI | InChI=1S/C20H16Cl2N4O2S/c1-11-10-12(2)24-19(23-11)26-20(29)25-17(27)9-7-13-6-8-16(28-13)14-4-3-5-15(21)18(14)22/h3-10H,1-2H3,(H2,23,24,25,26,27,29)/b9-7+ |
| InChIKey | QBNRNGLSSJMHGA-VQHVLOKHSA-N |
| XLogP | 5.19 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.35 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|