C14H10Cl2N2O2S — CID 132591100
(E)-N-carbamothioyl-3-[5-(2,3-dichlorophenyl)furan-2-yl]prop-2-enamide (PubChem CID 132591100) has the molecular formula C14H10Cl2N2O2S and a molecular weight of 341.22 g/mol. Its IUPAC name is (E)-N-carbamothioyl-3-[5-(2,3-dichlorophenyl)furan-2-yl]prop-2-enamide.
| Compound Name | (E)-N-carbamothioyl-3-[5-(2,3-dichlorophenyl)furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 132591100 |
| Molecular Formula | C14H10Cl2N2O2S |
| Molecular Weight | 341.22 g/mol |
| Exact Mass | 339.98 |
| IUPAC Name | (E)-N-carbamothioyl-3-[5-(2,3-dichlorophenyl)furan-2-yl]prop-2-enamide |
| SMILES | NC(=S)NC(=O)/C=C/c1ccc(-c2cccc(Cl)c2Cl)o1 |
| InChI | InChI=1S/C14H10Cl2N2O2S/c15-10-3-1-2-9(13(10)16)11-6-4-8(20-11)5-7-12(19)18-14(17)21/h1-7H,(H3,17,18,19,21)/b7-5+ |
| InChIKey | FRMFZFLJKXXDIS-FNORWQNLSA-N |
| XLogP | 3.63 |
| TPSA | 68.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.22 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|