C22H19Cl2N3O2S — CID 3910951
3-[5-(2,3-dichlorophenyl)furan-2-yl]-N-[[4-(dimethylamino)phenyl]carbamothioyl]prop-2-enamide (PubChem CID 3910951) has the molecular formula C22H19Cl2N3O2S and a molecular weight of 460.39 g/mol. Its IUPAC name is 3-[5-(2,3-dichlorophenyl)furan-2-yl]-N-[[4-(dimethylamino)phenyl]carbamothioyl]prop-2-enamide.
| Compound Name | 3-[5-(2,3-dichlorophenyl)furan-2-yl]-N-[[4-(dimethylamino)phenyl]carbamothioyl]prop-2-enamide |
|---|---|
| PubChem CID | 3910951 |
| Molecular Formula | C22H19Cl2N3O2S |
| Molecular Weight | 460.39 g/mol |
| Exact Mass | 459.06 |
| IUPAC Name | 3-[5-(2,3-dichlorophenyl)furan-2-yl]-N-[[4-(dimethylamino)phenyl]carbamothioyl]prop-2-enamide |
| SMILES | CN(C)c1ccc(NC(=S)NC(=O)C=Cc2ccc(-c3cccc(Cl)c3Cl)o2)cc1 |
| InChI | InChI=1S/C22H19Cl2N3O2S/c1-27(2)15-8-6-14(7-9-15)25-22(30)26-20(28)13-11-16-10-12-19(29-16)17-4-3-5-18(23)21(17)24/h3-13H,1-2H3,(H2,25,26,28,30) |
| InChIKey | OFBPSJAIQCYAJV-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 57.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.39 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|