C28H21Cl2N3O3S — CID 5240097
N-[4-[3-[5-(2,3-dichlorophenyl)furan-2-yl]prop-2-enoylcarbamothioylamino]-2-methylphenyl]benzamide (PubChem CID 5240097) has the molecular formula C28H21Cl2N3O3S and a molecular weight of 550.47 g/mol. Its IUPAC name is N-[4-[3-[5-(2,3-dichlorophenyl)furan-2-yl]prop-2-enoylcarbamothioylamino]-2-methylphenyl]benzamide.
| Compound Name | N-[4-[3-[5-(2,3-dichlorophenyl)furan-2-yl]prop-2-enoylcarbamothioylamino]-2-methylphenyl]benzamide |
|---|---|
| PubChem CID | 5240097 |
| Molecular Formula | C28H21Cl2N3O3S |
| Molecular Weight | 550.47 g/mol |
| Exact Mass | 549.07 |
| IUPAC Name | N-[4-[3-[5-(2,3-dichlorophenyl)furan-2-yl]prop-2-enoylcarbamothioylamino]-2-methylphenyl]benzamide |
| SMILES | Cc1cc(NC(=S)NC(=O)C=Cc2ccc(-c3cccc(Cl)c3Cl)o2)ccc1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C28H21Cl2N3O3S/c1-17-16-19(10-13-23(17)32-27(35)18-6-3-2-4-7-18)31-28(37)33-25(34)15-12-20-11-14-24(36-20)21-8-5-9-22(29)26(21)30/h2-16H,1H3,(H,32,35)(H2,31,33,34,37) |
| InChIKey | AIUCRIFHDQPLHE-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 83.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.47 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|