C21H14Cl2N2O4S — CID 17103608
2-[[(E)-3-[5-(2,3-dichlorophenyl)furan-2-yl]prop-2-enoyl]carbamothioylamino]benzoic acid (PubChem CID 17103608) has the molecular formula C21H14Cl2N2O4S and a molecular weight of 461.33 g/mol. Its IUPAC name is 2-[[(E)-3-[5-(2,3-dichlorophenyl)furan-2-yl]prop-2-enoyl]carbamothioylamino]benzoic acid.
| Compound Name | 2-[[(E)-3-[5-(2,3-dichlorophenyl)furan-2-yl]prop-2-enoyl]carbamothioylamino]benzoic acid |
|---|---|
| PubChem CID | 17103608 |
| Molecular Formula | C21H14Cl2N2O4S |
| Molecular Weight | 461.33 g/mol |
| Exact Mass | 460.01 |
| IUPAC Name | 2-[[(E)-3-[5-(2,3-dichlorophenyl)furan-2-yl]prop-2-enoyl]carbamothioylamino]benzoic acid |
| SMILES | O=C(/C=C/c1ccc(-c2cccc(Cl)c2Cl)o1)NC(=S)Nc1ccccc1C(=O)O |
| InChI | InChI=1S/C21H14Cl2N2O4S/c22-15-6-3-5-14(19(15)23)17-10-8-12(29-17)9-11-18(26)25-21(30)24-16-7-2-1-4-13(16)20(27)28/h1-11H,(H,27,28)(H2,24,25,26,30)/b11-9+ |
| InChIKey | LGBNTHZCWFKWHS-PKNBQFBNSA-N |
| XLogP | 5.48 |
| TPSA | 91.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.33 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|