C20H12Cl4N2O2S — CID 17113915
(E)-N-[(2,3-dichlorophenyl)carbamothioyl]-3-[5-(2,4-dichlorophenyl)furan-2-yl]prop-2-enamide (PubChem CID 17113915) has the molecular formula C20H12Cl4N2O2S and a molecular weight of 486.21 g/mol. Its IUPAC name is (E)-N-[(2,3-dichlorophenyl)carbamothioyl]-3-[5-(2,4-dichlorophenyl)furan-2-yl]prop-2-enamide.
| Compound Name | (E)-N-[(2,3-dichlorophenyl)carbamothioyl]-3-[5-(2,4-dichlorophenyl)furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 17113915 |
| Molecular Formula | C20H12Cl4N2O2S |
| Molecular Weight | 486.21 g/mol |
| Exact Mass | 483.94 |
| IUPAC Name | (E)-N-[(2,3-dichlorophenyl)carbamothioyl]-3-[5-(2,4-dichlorophenyl)furan-2-yl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(-c2ccc(Cl)cc2Cl)o1)NC(=S)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C20H12Cl4N2O2S/c21-11-4-7-13(15(23)10-11)17-8-5-12(28-17)6-9-18(27)26-20(29)25-16-3-1-2-14(22)19(16)24/h1-10H,(H2,25,26,27,29)/b9-6+ |
| InChIKey | DUYXNDXKEJCFSP-RMKNXTFCSA-N |
| XLogP | 7.09 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.21 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|