C24H16Cl2N2O3S — CID 6112594
(E)-3-[5-(2,4-dichlorophenyl)furan-2-yl]-N-[(6-hydroxynaphthalen-1-yl)carbamothioyl]prop-2-enamide (PubChem CID 6112594) has the molecular formula C24H16Cl2N2O3S and a molecular weight of 483.38 g/mol. Its IUPAC name is (E)-3-[5-(2,4-dichlorophenyl)furan-2-yl]-N-[(6-hydroxynaphthalen-1-yl)carbamothioyl]prop-2-enamide.
| Compound Name | (E)-3-[5-(2,4-dichlorophenyl)furan-2-yl]-N-[(6-hydroxynaphthalen-1-yl)carbamothioyl]prop-2-enamide |
|---|---|
| PubChem CID | 6112594 |
| Molecular Formula | C24H16Cl2N2O3S |
| Molecular Weight | 483.38 g/mol |
| Exact Mass | 482.03 |
| IUPAC Name | (E)-3-[5-(2,4-dichlorophenyl)furan-2-yl]-N-[(6-hydroxynaphthalen-1-yl)carbamothioyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(-c2ccc(Cl)cc2Cl)o1)NC(=S)Nc1cccc2cc(O)ccc12 |
| InChI | InChI=1S/C24H16Cl2N2O3S/c25-15-4-8-19(20(26)13-15)22-10-6-17(31-22)7-11-23(30)28-24(32)27-21-3-1-2-14-12-16(29)5-9-18(14)21/h1-13,29H,(H2,27,28,30,32)/b11-7+ |
| InChIKey | LSOMQCMNAWAGCQ-YRNVUSSQSA-N |
| XLogP | 6.64 |
| TPSA | 74.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.38 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|