C20H16N2O2S — CID 6152566
(E)-N-[(6-hydroxynaphthalen-1-yl)carbamothioyl]-3-phenylprop-2-enamide (PubChem CID 6152566) has the molecular formula C20H16N2O2S and a molecular weight of 348.43 g/mol. Its IUPAC name is (E)-N-[(6-hydroxynaphthalen-1-yl)carbamothioyl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[(6-hydroxynaphthalen-1-yl)carbamothioyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 6152566 |
| Molecular Formula | C20H16N2O2S |
| Molecular Weight | 348.43 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | (E)-N-[(6-hydroxynaphthalen-1-yl)carbamothioyl]-3-phenylprop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1)NC(=S)Nc1cccc2cc(O)ccc12 |
| InChI | InChI=1S/C20H16N2O2S/c23-16-10-11-17-15(13-16)7-4-8-18(17)21-20(25)22-19(24)12-9-14-5-2-1-3-6-14/h1-13,23H,(H2,21,22,24,25)/b12-9+ |
| InChIKey | HWDVWHCWIJXQQA-FMIVXFBMSA-N |
| XLogP | 4.07 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.43 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|