C21H13Cl3N2O4S — CID 17113954
2-chloro-5-[[(E)-3-[5-(2,4-dichlorophenyl)furan-2-yl]prop-2-enoyl]carbamothioylamino]benzoic acid (PubChem CID 17113954) has the molecular formula C21H13Cl3N2O4S and a molecular weight of 495.77 g/mol. Its IUPAC name is 2-chloro-5-[[(E)-3-[5-(2,4-dichlorophenyl)furan-2-yl]prop-2-enoyl]carbamothioylamino]benzoic acid.
| Compound Name | 2-chloro-5-[[(E)-3-[5-(2,4-dichlorophenyl)furan-2-yl]prop-2-enoyl]carbamothioylamino]benzoic acid |
|---|---|
| PubChem CID | 17113954 |
| Molecular Formula | C21H13Cl3N2O4S |
| Molecular Weight | 495.77 g/mol |
| Exact Mass | 493.97 |
| IUPAC Name | 2-chloro-5-[[(E)-3-[5-(2,4-dichlorophenyl)furan-2-yl]prop-2-enoyl]carbamothioylamino]benzoic acid |
| SMILES | O=C(/C=C/c1ccc(-c2ccc(Cl)cc2Cl)o1)NC(=S)Nc1ccc(Cl)c(C(=O)O)c1 |
| InChI | InChI=1S/C21H13Cl3N2O4S/c22-11-1-5-14(17(24)9-11)18-7-3-13(30-18)4-8-19(27)26-21(31)25-12-2-6-16(23)15(10-12)20(28)29/h1-10H,(H,28,29)(H2,25,26,27,31)/b8-4+ |
| InChIKey | ARHRJRFMJXVWFZ-XBXARRHUSA-N |
| XLogP | 6.13 |
| TPSA | 91.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.77 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|