C29H17Cl3N2O4S — CID 3933108
N-[[3-chloro-4-(2-oxochromen-3-yl)phenyl]carbamothioyl]-3-[5-(2,4-dichlorophenyl)furan-2-yl]prop-2-enamide (PubChem CID 3933108) has the molecular formula C29H17Cl3N2O4S and a molecular weight of 595.89 g/mol. Its IUPAC name is N-[[3-chloro-4-(2-oxochromen-3-yl)phenyl]carbamothioyl]-3-[5-(2,4-dichlorophenyl)furan-2-yl]prop-2-enamide.
| Compound Name | N-[[3-chloro-4-(2-oxochromen-3-yl)phenyl]carbamothioyl]-3-[5-(2,4-dichlorophenyl)furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 3933108 |
| Molecular Formula | C29H17Cl3N2O4S |
| Molecular Weight | 595.89 g/mol |
| Exact Mass | 594.00 |
| IUPAC Name | N-[[3-chloro-4-(2-oxochromen-3-yl)phenyl]carbamothioyl]-3-[5-(2,4-dichlorophenyl)furan-2-yl]prop-2-enamide |
| SMILES | O=C(C=Cc1ccc(-c2ccc(Cl)cc2Cl)o1)NC(=S)Nc1ccc(-c2cc3ccccc3oc2=O)c(Cl)c1 |
| InChI | InChI=1S/C29H17Cl3N2O4S/c30-17-5-9-21(23(31)14-17)26-11-7-19(37-26)8-12-27(35)34-29(39)33-18-6-10-20(24(32)15-18)22-13-16-3-1-2-4-25(16)38-28(22)36/h1-15H,(H2,33,34,35,39) |
| InChIKey | YFUFNFMKUKNUKM-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.89 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|