C27H15Cl3N2O4S — CID 5094011
N-[[3-chloro-4-(2-oxochromen-3-yl)phenyl]carbamothioyl]-5-(2,4-dichlorophenyl)furan-2-carboxamide (PubChem CID 5094011) has the molecular formula C27H15Cl3N2O4S and a molecular weight of 569.85 g/mol. Its IUPAC name is N-[[3-chloro-4-(2-oxochromen-3-yl)phenyl]carbamothioyl]-5-(2,4-dichlorophenyl)furan-2-carboxamide.
| Compound Name | N-[[3-chloro-4-(2-oxochromen-3-yl)phenyl]carbamothioyl]-5-(2,4-dichlorophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 5094011 |
| Molecular Formula | C27H15Cl3N2O4S |
| Molecular Weight | 569.85 g/mol |
| Exact Mass | 567.98 |
| IUPAC Name | N-[[3-chloro-4-(2-oxochromen-3-yl)phenyl]carbamothioyl]-5-(2,4-dichlorophenyl)furan-2-carboxamide |
| SMILES | O=C(NC(=S)Nc1ccc(-c2cc3ccccc3oc2=O)c(Cl)c1)c1ccc(-c2ccc(Cl)cc2Cl)o1 |
| InChI | InChI=1S/C27H15Cl3N2O4S/c28-15-5-7-18(20(29)12-15)23-9-10-24(35-23)25(33)32-27(37)31-16-6-8-17(21(30)13-16)19-11-14-3-1-2-4-22(14)36-26(19)34/h1-13H,(H2,31,32,33,37) |
| InChIKey | FPYCBFIJIHZSAV-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.85 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|