C21H12Cl2N2O4S — CID 3450277
5-(2,4-dichlorophenyl)-N-[(2-oxochromen-6-yl)carbamothioyl]furan-2-carboxamide (PubChem CID 3450277) has the molecular formula C21H12Cl2N2O4S and a molecular weight of 459.31 g/mol. Its IUPAC name is 5-(2,4-dichlorophenyl)-N-[(2-oxochromen-6-yl)carbamothioyl]furan-2-carboxamide.
| Compound Name | 5-(2,4-dichlorophenyl)-N-[(2-oxochromen-6-yl)carbamothioyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 3450277 |
| Molecular Formula | C21H12Cl2N2O4S |
| Molecular Weight | 459.31 g/mol |
| Exact Mass | 457.99 |
| IUPAC Name | 5-(2,4-dichlorophenyl)-N-[(2-oxochromen-6-yl)carbamothioyl]furan-2-carboxamide |
| SMILES | O=C(NC(=S)Nc1ccc2oc(=O)ccc2c1)c1ccc(-c2ccc(Cl)cc2Cl)o1 |
| InChI | InChI=1S/C21H12Cl2N2O4S/c22-12-2-4-14(15(23)10-12)17-6-7-18(28-17)20(27)25-21(30)24-13-3-5-16-11(9-13)1-8-19(26)29-16/h1-10H,(H2,24,25,27,30) |
| InChIKey | ALOAWWIQBKOZKW-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.31 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|